C26H28N4O6S — CID 25067177
(2S)-2-[[8-[[4-(dimethylamino)phenyl]carbamoylamino]dibenzofuran-3-yl]sulfonylamino]-3-methylbutanoic acid (PubChem CID 25067177) has the molecular formula C26H28N4O6S and a molecular weight of 524.60 g/mol. Its IUPAC name is (2S)-2-[[8-[[4-(dimethylamino)phenyl]carbamoylamino]dibenzofuran-3-yl]sulfonylamino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[8-[[4-(dimethylamino)phenyl]carbamoylamino]dibenzofuran-3-yl]sulfonylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 25067177 |
| Molecular Formula | C26H28N4O6S |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | (2S)-2-[[8-[[4-(dimethylamino)phenyl]carbamoylamino]dibenzofuran-3-yl]sulfonylamino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NS(=O)(=O)c1ccc2c(c1)oc1ccc(NC(=O)Nc3ccc(N(C)C)cc3)cc12)C(=O)O |
| InChI | InChI=1S/C26H28N4O6S/c1-15(2)24(25(31)32)29-37(34,35)19-10-11-20-21-13-17(7-12-22(21)36-23(20)14-19)28-26(33)27-16-5-8-18(9-6-16)30(3)4/h5-15,24,29H,1-4H3,(H,31,32)(H2,27,28,33)/t24-/m0/s1 |
| InChIKey | KZPFPAUQQHYNRV-DEOSSOPVSA-N |
| XLogP | 4.68 |
| TPSA | 140.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|