C25H29NO5S — CID 68506186
(2R)-2-[[7-(2-cyclohexylethenyl)dibenzofuran-2-yl]sulfonylamino]-3-methylbutanoic acid (PubChem CID 68506186) has the molecular formula C25H29NO5S and a molecular weight of 455.58 g/mol. Its IUPAC name is (2R)-2-[[7-(2-cyclohexylethenyl)dibenzofuran-2-yl]sulfonylamino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[[7-(2-cyclohexylethenyl)dibenzofuran-2-yl]sulfonylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 68506186 |
| Molecular Formula | C25H29NO5S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | (2R)-2-[[7-(2-cyclohexylethenyl)dibenzofuran-2-yl]sulfonylamino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](NS(=O)(=O)c1ccc2oc3cc(C=CC4CCCCC4)ccc3c2c1)C(=O)O |
| InChI | InChI=1S/C25H29NO5S/c1-16(2)24(25(27)28)26-32(29,30)19-11-13-22-21(15-19)20-12-10-18(14-23(20)31-22)9-8-17-6-4-3-5-7-17/h8-17,24,26H,3-7H2,1-2H3,(H,27,28)/t24-/m1/s1 |
| InChIKey | ZIFKIRZKPQSHGA-XMMPIXPASA-N |
| XLogP | 5.57 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |