C24H27N3O — CID 25072993
4-[(benzylamino)methyl]-N'-(4-propan-2-ylphenyl)benzohydrazide (PubChem CID 25072993) has the molecular formula C24H27N3O and a molecular weight of 373.50 g/mol. Its IUPAC name is 4-[(benzylamino)methyl]-N'-(4-propan-2-ylphenyl)benzohydrazide.
| Compound Name | 4-[(benzylamino)methyl]-N'-(4-propan-2-ylphenyl)benzohydrazide |
|---|---|
| PubChem CID | 25072993 |
| Molecular Formula | C24H27N3O |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 4-[(benzylamino)methyl]-N'-(4-propan-2-ylphenyl)benzohydrazide |
| SMILES | CC(C)c1ccc(NNC(=O)c2ccc(CNCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H27N3O/c1-18(2)21-12-14-23(15-13-21)26-27-24(28)22-10-8-20(9-11-22)17-25-16-19-6-4-3-5-7-19/h3-15,18,25-26H,16-17H2,1-2H3,(H,27,28) |
| InChIKey | OHLBVYAKXIYUII-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|