C27H26N4O2 — CID 69190689
1-[[4-(anilinocarbamoyl)phenyl]methyl]-3-(1-naphthalen-1-ylethyl)urea (PubChem CID 69190689) has the molecular formula C27H26N4O2 and a molecular weight of 438.53 g/mol. Its IUPAC name is 1-[[4-(anilinocarbamoyl)phenyl]methyl]-3-(1-naphthalen-1-ylethyl)urea.
| Compound Name | 1-[[4-(anilinocarbamoyl)phenyl]methyl]-3-(1-naphthalen-1-ylethyl)urea |
|---|---|
| PubChem CID | 69190689 |
| Molecular Formula | C27H26N4O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 1-[[4-(anilinocarbamoyl)phenyl]methyl]-3-(1-naphthalen-1-ylethyl)urea |
| SMILES | CC(NC(=O)NCc1ccc(C(=O)NNc2ccccc2)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C27H26N4O2/c1-19(24-13-7-9-21-8-5-6-12-25(21)24)29-27(33)28-18-20-14-16-22(17-15-20)26(32)31-30-23-10-3-2-4-11-23/h2-17,19,30H,18H2,1H3,(H,31,32)(H2,28,29,33) |
| InChIKey | ZCPXGYTUYKKKNC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|