C25H30Cl2F3N5O — CID 25074049
N-[[3-[1-[(3Z)-4,5-dichloropenta-1,3-dien-2-yl]cyclopropyl]-1,2,4-oxadiazol-5-yl]methyl]-2-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]ethanamine (PubChem CID 25074049) has the molecular formula C25H30Cl2F3N5O and a molecular weight of 544.45 g/mol. Its IUPAC name is N-[[3-[1-[(3Z)-4,5-dichloropenta-1,3-dien-2-yl]cyclopropyl]-1,2,4-oxadiazol-5-yl]methyl]-2-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]ethanamine.
| Compound Name | N-[[3-[1-[(3Z)-4,5-dichloropenta-1,3-dien-2-yl]cyclopropyl]-1,2,4-oxadiazol-5-yl]methyl]-2-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]ethanamine |
|---|---|
| PubChem CID | 25074049 |
| Molecular Formula | C25H30Cl2F3N5O |
| Molecular Weight | 544.45 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | N-[[3-[1-[(3Z)-4,5-dichloropenta-1,3-dien-2-yl]cyclopropyl]-1,2,4-oxadiazol-5-yl]methyl]-2-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]ethanamine |
| SMILES | C=C(/C=C(\Cl)CCl)C1(c2noc(CNCCN3CCN(Cc4cccc(C(F)(F)F)c4)CC3)n2)CC1 |
| InChI | InChI=1S/C25H30Cl2F3N5O/c1-18(13-21(27)15-26)24(5-6-24)23-32-22(36-33-23)16-31-7-8-34-9-11-35(12-10-34)17-19-3-2-4-20(14-19)25(28,29)30/h2-4,13-14,31H,1,5-12,15-17H2/b21-13- |
| InChIKey | NMMCXGOWKDJTJX-BKUYFWCQSA-N |
| XLogP | 4.95 |
| TPSA | 57.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.45 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|