C26H40N2O6 — CID 25075146
pent-4-enyl (5R,6S,7S)-2-[butyl(prop-2-enyl)carbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 25075146) has the molecular formula C26H40N2O6 and a molecular weight of 476.61 g/mol. Its IUPAC name is pent-4-enyl (5R,6S,7S)-2-[butyl(prop-2-enyl)carbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | pent-4-enyl (5R,6S,7S)-2-[butyl(prop-2-enyl)carbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 25075146 |
| Molecular Formula | C26H40N2O6 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | pent-4-enyl (5R,6S,7S)-2-[butyl(prop-2-enyl)carbamoyl]-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCOC(=O)[C@@H]1[C@@H]2CCC3(O2)C(C(=O)N(CC=C)CCCC)N(C(CC)CO)C(=O)[C@H]13 |
| InChI | InChI=1S/C26H40N2O6/c1-5-9-11-16-33-25(32)20-19-12-13-26(34-19)21(20)23(30)28(18(8-4)17-29)22(26)24(31)27(14-7-3)15-10-6-2/h5,7,18-22,29H,1,3,6,8-17H2,2,4H3/t18?,19-,20+,21-,22?,26?/m0/s1 |
| InChIKey | DDENLOGNWCVOPF-DWKJRVQQSA-N |
| XLogP | 2.46 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|