C31H50N2O6 — CID 25082178
hex-5-enyl (5R,6S,7S)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 25082178) has the molecular formula C31H50N2O6 and a molecular weight of 546.75 g/mol. Its IUPAC name is hex-5-enyl (5R,6S,7S)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | hex-5-enyl (5R,6S,7S)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 25082178 |
| Molecular Formula | C31H50N2O6 |
| Molecular Weight | 546.75 g/mol |
| Exact Mass | 546.37 |
| IUPAC Name | hex-5-enyl (5R,6S,7S)-3-[(2S)-1-hydroxybutan-2-yl]-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCCOC(=O)[C@@H]1[C@@H]2CCC3(O2)C(C(=O)N(CC=C)C(C)(C)CC(C)(C)C)N([C@@H](CC)CO)C(=O)[C@H]13 |
| InChI | InChI=1S/C31H50N2O6/c1-9-12-13-14-18-38-28(37)23-22-15-16-31(39-22)24(23)26(35)33(21(11-3)19-34)25(31)27(36)32(17-10-2)30(7,8)20-29(4,5)6/h9-10,21-25,34H,1-2,11-20H2,3-8H3/t21-,22-,23+,24-,25?,31?/m0/s1 |
| InChIKey | BMHUHYPLVKBFAQ-GRQIDBTASA-N |
| XLogP | 4.26 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.75 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|