C23H36N2O5S — CID 25075309
(5S,6R,7S)-2-[tert-butyl(prop-2-enyl)carbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid (PubChem CID 25075309) has the molecular formula C23H36N2O5S and a molecular weight of 452.62 g/mol. Its IUPAC name is (5S,6R,7S)-2-[tert-butyl(prop-2-enyl)carbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid.
| Compound Name | (5S,6R,7S)-2-[tert-butyl(prop-2-enyl)carbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
|---|---|
| PubChem CID | 25075309 |
| Molecular Formula | C23H36N2O5S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | (5S,6R,7S)-2-[tert-butyl(prop-2-enyl)carbamoyl]-3-(6-hydroxyhexyl)-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
| SMILES | C=CCN(C(=O)C1N(CCCCCCO)C(=O)[C@@H]2[C@H](C(=O)O)[C@@H]3CCC12S3)C(C)(C)C |
| InChI | InChI=1S/C23H36N2O5S/c1-5-12-25(22(2,3)4)20(28)18-23-11-10-15(31-23)16(21(29)30)17(23)19(27)24(18)13-8-6-7-9-14-26/h5,15-18,26H,1,6-14H2,2-4H3,(H,29,30)/t15-,16+,17-,18?,23?/m0/s1 |
| InChIKey | DUSRSIJDCAPENF-QSICRKIHSA-N |
| XLogP | 2.53 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|