C25H40N2O5S — CID 25075340
(5S,6S,7R)-3-(4-hydroxybutyl)-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid (PubChem CID 25075340) has the molecular formula C25H40N2O5S and a molecular weight of 480.67 g/mol. Its IUPAC name is (5S,6S,7R)-3-(4-hydroxybutyl)-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid.
| Compound Name | (5S,6S,7R)-3-(4-hydroxybutyl)-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
|---|---|
| PubChem CID | 25075340 |
| Molecular Formula | C25H40N2O5S |
| Molecular Weight | 480.67 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | (5S,6S,7R)-3-(4-hydroxybutyl)-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
| SMILES | C=CCN(C(=O)C1N(CCCCO)C(=O)[C@@H]2[C@@H](C(=O)O)[C@H]3CCC12S3)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C25H40N2O5S/c1-7-12-27(24(5,6)15-23(2,3)4)21(30)19-25-11-10-16(33-25)17(22(31)32)18(25)20(29)26(19)13-8-9-14-28/h7,16-19,28H,1,8-15H2,2-6H3,(H,31,32)/t16-,17+,18+,19?,25?/m1/s1 |
| InChIKey | DZCIDZWOLDPZMY-DHMVEAENSA-N |
| XLogP | 3.16 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.67 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|