About oxotungsten;hydroxide;phosphate
oxotungsten;hydroxide;phosphate (PubChem CID 25076646) has the molecular formula HO6PW-4
and a molecular weight of 311.82 g/mol. Its IUPAC name is oxotungsten;hydroxide;phosphate.
Molecular Properties
| Compound Name | oxotungsten;hydroxide;phosphate |
| PubChem CID | 25076646 |
| Molecular Formula | HO6PW-4 |
| Molecular Weight | 311.82 g/mol |
| Exact Mass | 311.90 |
| IUPAC Name | oxotungsten;hydroxide;phosphate |
| SMILES | O=P([O-])([O-])[O-].O=[W].[OH-] |
| InChI | InChI=1S/H3O4P.H2O.O.W/c1-5(2,3)4;;;/h(H3,1,2,3,4);1H2;;/p-4 |
| InChIKey | VIUDZQKEITYTJB-UHFFFAOYSA-J |
| XLogP | -3.12 |
| TPSA | 133.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.82 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze oxotungsten;hydroxide;phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxotungsten;hydroxide;phosphate?
The IUPAC name of oxotungsten;hydroxide;phosphate (CID 25076646) is oxotungsten;hydroxide;phosphate.
What is the SMILES notation for oxotungsten;hydroxide;phosphate?
The canonical SMILES for oxotungsten;hydroxide;phosphate is O=P([O-])([O-])[O-].O=[W].[OH-].
What is the InChIKey of oxotungsten;hydroxide;phosphate?
The InChIKey is VIUDZQKEITYTJB-UHFFFAOYSA-J. The full InChI is InChI=1S/H3O4P.H2O.O.W/c1-5(2,3)4;;;/h(H3,1,2,3,4);1H2;;/p-4.
What are the key properties of oxotungsten;hydroxide;phosphate?
oxotungsten;hydroxide;phosphate has a molecular weight of 311.82 g/mol, XLogP of -3.12, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for oxotungsten;hydroxide;phosphate is sourced from PubChem (CID 25076646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).