C27H42N2O6 — CID 25076738
but-3-enyl (5R,6R,7R)-3-(5-hydroxypentyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 25076738) has the molecular formula C27H42N2O6 and a molecular weight of 490.64 g/mol. Its IUPAC name is but-3-enyl (5R,6R,7R)-3-(5-hydroxypentyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | but-3-enyl (5R,6R,7R)-3-(5-hydroxypentyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 25076738 |
| Molecular Formula | C27H42N2O6 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.30 |
| IUPAC Name | but-3-enyl (5R,6R,7R)-3-(5-hydroxypentyl)-4-oxo-2-[pentyl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCOC(=O)[C@@H]1[C@H]2C(=O)N(CCCCCO)C(C(=O)N(CC=C)CCCCC)C23CC[C@H]1O3 |
| InChI | InChI=1S/C27H42N2O6/c1-4-7-10-16-28(15-6-3)25(32)23-27-14-13-20(35-27)21(26(33)34-19-8-5-2)22(27)24(31)29(23)17-11-9-12-18-30/h5-6,20-23,30H,2-4,7-19H2,1H3/t20-,21+,22+,23?,27?/m1/s1 |
| InChIKey | TYJYXNFRJKOKNR-SAFCFDRRSA-N |
| XLogP | 2.85 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|