C29H47N3O5 — CID 25090162
(5R,6R,7R)-3-(5-hydroxypentyl)-4-oxo-2-N-pentyl-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 25090162) has the molecular formula C29H47N3O5 and a molecular weight of 517.71 g/mol. Its IUPAC name is (5R,6R,7R)-3-(5-hydroxypentyl)-4-oxo-2-N-pentyl-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-3-(5-hydroxypentyl)-4-oxo-2-N-pentyl-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 25090162 |
| Molecular Formula | C29H47N3O5 |
| Molecular Weight | 517.71 g/mol |
| Exact Mass | 517.35 |
| IUPAC Name | (5R,6R,7R)-3-(5-hydroxypentyl)-4-oxo-2-N-pentyl-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(CCCCC)C(=O)C1N(CCCCCO)C(=O)[C@@H]2[C@@H](C(=O)N(CC=C)CCC)[C@H]3CCC12O3 |
| InChI | InChI=1S/C29H47N3O5/c1-5-9-11-19-31(18-8-4)28(36)25-29-15-14-22(37-29)23(26(34)30(16-6-2)17-7-3)24(29)27(35)32(25)20-12-10-13-21-33/h6,8,22-25,33H,2,4-5,7,9-21H2,1,3H3/t22-,23+,24+,25?,29?/m1/s1 |
| InChIKey | RVABRXUJKDIHPC-MZQLBTECSA-N |
| XLogP | 3.15 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.71 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|