C30H48N2O6 — CID 25078887
hex-5-enyl (5R,6R,7R)-3-(6-hydroxyhexyl)-4-oxo-2-[pentan-2-yl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 25078887) has the molecular formula C30H48N2O6 and a molecular weight of 532.72 g/mol. Its IUPAC name is hex-5-enyl (5R,6R,7R)-3-(6-hydroxyhexyl)-4-oxo-2-[pentan-2-yl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | hex-5-enyl (5R,6R,7R)-3-(6-hydroxyhexyl)-4-oxo-2-[pentan-2-yl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 25078887 |
| Molecular Formula | C30H48N2O6 |
| Molecular Weight | 532.72 g/mol |
| Exact Mass | 532.35 |
| IUPAC Name | hex-5-enyl (5R,6R,7R)-3-(6-hydroxyhexyl)-4-oxo-2-[pentan-2-yl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCCCOC(=O)[C@@H]1[C@H]2C(=O)N(CCCCCCO)C(C(=O)N(CC=C)C(C)CCC)C23CC[C@H]1O3 |
| InChI | InChI=1S/C30H48N2O6/c1-5-8-9-14-21-37-29(36)24-23-16-17-30(38-23)25(24)27(34)32(19-12-10-11-13-20-33)26(30)28(35)31(18-7-3)22(4)15-6-2/h5,7,22-26,33H,1,3,6,8-21H2,2,4H3/t22?,23-,24+,25+,26?,30?/m1/s1 |
| InChIKey | GFFYPZKJTXBIIJ-HCAJYVOFSA-N |
| XLogP | 4.02 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.72 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|