C22H32N2O6 — CID 25082124
but-3-enyl (5R,6R,7R)-3-(2-hydroxyethyl)-4-oxo-2-[propan-2-yl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 25082124) has the molecular formula C22H32N2O6 and a molecular weight of 420.51 g/mol. Its IUPAC name is but-3-enyl (5R,6R,7R)-3-(2-hydroxyethyl)-4-oxo-2-[propan-2-yl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | but-3-enyl (5R,6R,7R)-3-(2-hydroxyethyl)-4-oxo-2-[propan-2-yl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 25082124 |
| Molecular Formula | C22H32N2O6 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | but-3-enyl (5R,6R,7R)-3-(2-hydroxyethyl)-4-oxo-2-[propan-2-yl(prop-2-enyl)carbamoyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCOC(=O)[C@@H]1[C@H]2C(=O)N(CCO)C(C(=O)N(CC=C)C(C)C)C23CC[C@H]1O3 |
| InChI | InChI=1S/C22H32N2O6/c1-5-7-13-29-21(28)16-15-8-9-22(30-15)17(16)19(26)24(11-12-25)18(22)20(27)23(10-6-2)14(3)4/h5-6,14-18,25H,1-2,7-13H2,3-4H3/t15-,16+,17+,18?,22?/m1/s1 |
| InChIKey | GLYXJEJKNCQMSY-QRQVBILGSA-N |
| XLogP | 0.90 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|