About 1-(dimethylamino)ethyl carbamate
1-(dimethylamino)ethyl carbamate (PubChem CID 25079362) has the molecular formula C5H12N2O2
and a molecular weight of 132.16 g/mol. Its IUPAC name is 1-(dimethylamino)ethyl carbamate.
Molecular Properties
| Compound Name | 1-(dimethylamino)ethyl carbamate |
| PubChem CID | 25079362 |
| Molecular Formula | C5H12N2O2 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | 1-(dimethylamino)ethyl carbamate |
| SMILES | CC(OC(N)=O)N(C)C |
| InChI | InChI=1S/C5H12N2O2/c1-4(7(2)3)9-5(6)8/h4H,1-3H3,(H2,6,8) |
| InChIKey | LLMITOZMSCEYMQ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(dimethylamino)ethyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylamino)ethyl carbamate?
The IUPAC name of 1-(dimethylamino)ethyl carbamate (CID 25079362) is 1-(dimethylamino)ethyl carbamate.
What is the SMILES notation for 1-(dimethylamino)ethyl carbamate?
The canonical SMILES for 1-(dimethylamino)ethyl carbamate is CC(OC(N)=O)N(C)C.
What is the InChIKey of 1-(dimethylamino)ethyl carbamate?
The InChIKey is LLMITOZMSCEYMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O2/c1-4(7(2)3)9-5(6)8/h4H,1-3H3,(H2,6,8).
What are the key properties of 1-(dimethylamino)ethyl carbamate?
1-(dimethylamino)ethyl carbamate has a molecular weight of 132.16 g/mol, XLogP of -0.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylamino)ethyl carbamate is sourced from PubChem (CID 25079362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).