C6H13NO7 — CID 25087196
2-hydroxyethylazanium;2,3,4-trihydroxy-4-oxobutanoate (PubChem CID 25087196) has the molecular formula C6H13NO7 and a molecular weight of 211.17 g/mol. Its IUPAC name is 2-hydroxyethylazanium;2,3,4-trihydroxy-4-oxobutanoate.
| Compound Name | 2-hydroxyethylazanium;2,3,4-trihydroxy-4-oxobutanoate |
|---|---|
| PubChem CID | 25087196 |
| Molecular Formula | C6H13NO7 |
| Molecular Weight | 211.17 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 2-hydroxyethylazanium;2,3,4-trihydroxy-4-oxobutanoate |
| SMILES | O=C([O-])C(O)C(O)C(=O)O.[NH3+]CCO |
| InChI | InChI=1S/C4H6O6.C2H7NO/c5-1(3(7)8)2(6)4(9)10;3-1-2-4/h1-2,5-6H,(H,7,8)(H,9,10);4H,1-3H2 |
| InChIKey | RIAWEWHXZJUMCO-UHFFFAOYSA-N |
| XLogP | -5.24 |
| TPSA | 165.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.17 |
| LogP ≤ 5 | -5.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |