C24H41N3O5 — CID 25089873
(5R,6S,7S)-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-6-N-propyl-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 25089873) has the molecular formula C24H41N3O5 and a molecular weight of 451.61 g/mol. Its IUPAC name is (5R,6S,7S)-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-6-N-propyl-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-6-N-propyl-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 25089873 |
| Molecular Formula | C24H41N3O5 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.30 |
| IUPAC Name | (5R,6S,7S)-3-[(2R)-1-hydroxypropan-2-yl]-4-oxo-6-N-propyl-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCCNC(=O)[C@@H]1[C@@H]2CCC3(O2)C(C(=O)NC(C)(C)CC(C)(C)C)N([C@H](C)CO)C(=O)[C@H]13 |
| InChI | InChI=1S/C24H41N3O5/c1-8-11-25-19(29)16-15-9-10-24(32-15)17(16)21(31)27(14(2)12-28)18(24)20(30)26-23(6,7)13-22(3,4)5/h14-18,28H,8-13H2,1-7H3,(H,25,29)(H,26,30)/t14-,15+,16-,17+,18?,24?/m1/s1 |
| InChIKey | CJPWEYSBYUTWNK-INBHZCHQSA-N |
| XLogP | 1.60 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |