C10H6BrF3N2OS — CID 25093333
5-bromo-N-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-amine (PubChem CID 25093333) has the molecular formula C10H6BrF3N2OS and a molecular weight of 339.14 g/mol. Its IUPAC name is 5-bromo-N-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-amine.
| Compound Name | 5-bromo-N-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 25093333 |
| Molecular Formula | C10H6BrF3N2OS |
| Molecular Weight | 339.14 g/mol |
| Exact Mass | 337.93 |
| IUPAC Name | 5-bromo-N-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-amine |
| SMILES | FC(F)(F)Oc1ccc(Nc2ncc(Br)s2)cc1 |
| InChI | InChI=1S/C10H6BrF3N2OS/c11-8-5-15-9(18-8)16-6-1-3-7(4-2-6)17-10(12,13)14/h1-5H,(H,15,16) |
| InChIKey | DWHXSOQDXRRHTP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.14 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |