C24H23F3N6O — CID 25094196
N-[6-(butylamino)-3-pyridinyl]-1-(pyridin-4-ylmethyl)-5-(trifluoromethyl)pyrrolo[2,3-b]pyridine-2-carboxamide (PubChem CID 25094196) has the molecular formula C24H23F3N6O and a molecular weight of 468.48 g/mol. Its IUPAC name is N-[6-(butylamino)-3-pyridinyl]-1-(pyridin-4-ylmethyl)-5-(trifluoromethyl)pyrrolo[2,3-b]pyridine-2-carboxamide.
| Compound Name | N-[6-(butylamino)-3-pyridinyl]-1-(pyridin-4-ylmethyl)-5-(trifluoromethyl)pyrrolo[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 25094196 |
| Molecular Formula | C24H23F3N6O |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | N-[6-(butylamino)-3-pyridinyl]-1-(pyridin-4-ylmethyl)-5-(trifluoromethyl)pyrrolo[2,3-b]pyridine-2-carboxamide |
| SMILES | CCCCNc1ccc(NC(=O)c2cc3cc(C(F)(F)F)cnc3n2Cc2ccncc2)cn1 |
| InChI | InChI=1S/C24H23F3N6O/c1-2-3-8-29-21-5-4-19(14-30-21)32-23(34)20-12-17-11-18(24(25,26)27)13-31-22(17)33(20)15-16-6-9-28-10-7-16/h4-7,9-14H,2-3,8,15H2,1H3,(H,29,30)(H,32,34) |
| InChIKey | SAONNEDHGFCISH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|