C20H23ClN4O2 — CID 67416027
5-chloro-1-ethyl-N-[6-(3-methoxypropylamino)-3-pyridinyl]indole-2-carboxamide (PubChem CID 67416027) has the molecular formula C20H23ClN4O2 and a molecular weight of 386.88 g/mol. Its IUPAC name is 5-chloro-1-ethyl-N-[6-(3-methoxypropylamino)-3-pyridinyl]indole-2-carboxamide.
| Compound Name | 5-chloro-1-ethyl-N-[6-(3-methoxypropylamino)-3-pyridinyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 67416027 |
| Molecular Formula | C20H23ClN4O2 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 5-chloro-1-ethyl-N-[6-(3-methoxypropylamino)-3-pyridinyl]indole-2-carboxamide |
| SMILES | CCn1c(C(=O)Nc2ccc(NCCCOC)nc2)cc2cc(Cl)ccc21 |
| InChI | InChI=1S/C20H23ClN4O2/c1-3-25-17-7-5-15(21)11-14(17)12-18(25)20(26)24-16-6-8-19(23-13-16)22-9-4-10-27-2/h5-8,11-13H,3-4,9-10H2,1-2H3,(H,22,23)(H,24,26) |
| InChIKey | SIRDWCADQZYAMC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|