C24H22FNO6S — CID 25094696
diethyl 4-[[4-(4-fluorophenyl)phenyl]sulfonylamino]benzene-1,2-dicarboxylate (PubChem CID 25094696) has the molecular formula C24H22FNO6S and a molecular weight of 471.51 g/mol. Its IUPAC name is diethyl 4-[[4-(4-fluorophenyl)phenyl]sulfonylamino]benzene-1,2-dicarboxylate.
| Compound Name | diethyl 4-[[4-(4-fluorophenyl)phenyl]sulfonylamino]benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 25094696 |
| Molecular Formula | C24H22FNO6S |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | diethyl 4-[[4-(4-fluorophenyl)phenyl]sulfonylamino]benzene-1,2-dicarboxylate |
| SMILES | CCOC(=O)c1ccc(NS(=O)(=O)c2ccc(-c3ccc(F)cc3)cc2)cc1C(=O)OCC |
| InChI | InChI=1S/C24H22FNO6S/c1-3-31-23(27)21-14-11-19(15-22(21)24(28)32-4-2)26-33(29,30)20-12-7-17(8-13-20)16-5-9-18(25)10-6-16/h5-15,26H,3-4H2,1-2H3 |
| InChIKey | KLGXRUBSQHMDFY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |