C20H20N4OS — CID 25094945
2-phenyl-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 25094945) has the molecular formula C20H20N4OS and a molecular weight of 364.47 g/mol. Its IUPAC name is 2-phenyl-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-phenyl-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 25094945 |
| Molecular Formula | C20H20N4OS |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 2-phenyl-N-(2-piperazin-1-ylphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccccc1N1CCNCC1)c1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H20N4OS/c25-19(17-14-26-20(23-17)15-6-2-1-3-7-15)22-16-8-4-5-9-18(16)24-12-10-21-11-13-24/h1-9,14,21H,10-13H2,(H,22,25) |
| InChIKey | FTYPTPGIIWETQX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |