C16H11ClN2OS — CID 2744454
N-(4-chlorophenyl)-2-phenyl-1,3-thiazole-4-carboxamide (PubChem CID 2744454) has the molecular formula C16H11ClN2OS and a molecular weight of 314.80 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-phenyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(4-chlorophenyl)-2-phenyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 2744454 |
| Molecular Formula | C16H11ClN2OS |
| Molecular Weight | 314.80 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | N-(4-chlorophenyl)-2-phenyl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H11ClN2OS/c17-12-6-8-13(9-7-12)18-15(20)14-10-21-16(19-14)11-4-2-1-3-5-11/h1-10H,(H,18,20) |
| InChIKey | UDSYJVBVXRWNKE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.80 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |