C15H10ClN3OS — CID 2824236
N-(2-chlorophenyl)-2-pyridin-3-yl-1,3-thiazole-4-carboxamide (PubChem CID 2824236) has the molecular formula C15H10ClN3OS and a molecular weight of 315.79 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-pyridin-3-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-chlorophenyl)-2-pyridin-3-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 2824236 |
| Molecular Formula | C15H10ClN3OS |
| Molecular Weight | 315.79 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | N-(2-chlorophenyl)-2-pyridin-3-yl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccccc1Cl)c1csc(-c2cccnc2)n1 |
| InChI | InChI=1S/C15H10ClN3OS/c16-11-5-1-2-6-12(11)18-14(20)13-9-21-15(19-13)10-4-3-7-17-8-10/h1-9H,(H,18,20) |
| InChIKey | RQNRKBPJNOGFQG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.79 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |