C25H17ClN4 — CID 25095690
3-[3-[(4-chlorophenyl)methyl]-5-phenylimidazol-4-yl]-1H-indole-6-carbonitrile (PubChem CID 25095690) has the molecular formula C25H17ClN4 and a molecular weight of 408.89 g/mol. Its IUPAC name is 3-[3-[(4-chlorophenyl)methyl]-5-phenylimidazol-4-yl]-1H-indole-6-carbonitrile.
| Compound Name | 3-[3-[(4-chlorophenyl)methyl]-5-phenylimidazol-4-yl]-1H-indole-6-carbonitrile |
|---|---|
| PubChem CID | 25095690 |
| Molecular Formula | C25H17ClN4 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 3-[3-[(4-chlorophenyl)methyl]-5-phenylimidazol-4-yl]-1H-indole-6-carbonitrile |
| SMILES | N#Cc1ccc2c(-c3c(-c4ccccc4)ncn3Cc3ccc(Cl)cc3)c[nH]c2c1 |
| InChI | InChI=1S/C25H17ClN4/c26-20-9-6-17(7-10-20)15-30-16-29-24(19-4-2-1-3-5-19)25(30)22-14-28-23-12-18(13-27)8-11-21(22)23/h1-12,14,16,28H,15H2 |
| InChIKey | UFAKDAZMXUXIIC-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 57.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |