C11H13F3N2O4S — CID 25095872
1,1,1-trifluoro-N-[2-methoxy-6-[(E)-N-methoxy-C-methylcarbonimidoyl]phenyl]methanesulfonamide (PubChem CID 25095872) has the molecular formula C11H13F3N2O4S and a molecular weight of 326.30 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[2-methoxy-6-[(E)-N-methoxy-C-methylcarbonimidoyl]phenyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[2-methoxy-6-[(E)-N-methoxy-C-methylcarbonimidoyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 25095872 |
| Molecular Formula | C11H13F3N2O4S |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 1,1,1-trifluoro-N-[2-methoxy-6-[(E)-N-methoxy-C-methylcarbonimidoyl]phenyl]methanesulfonamide |
| SMILES | CO/N=C(\C)c1cccc(OC)c1NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C11H13F3N2O4S/c1-7(15-20-3)8-5-4-6-9(19-2)10(8)16-21(17,18)11(12,13)14/h4-6,16H,1-3H3/b15-7+ |
| InChIKey | UDTBFPRAQONRCI-VIZOYTHASA-N |
| XLogP | 2.33 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|