C13H9ClN2O — CID 25096012
N-(3-chlorophenyl)furo[3,2-c]pyridin-4-amine (PubChem CID 25096012) has the molecular formula C13H9ClN2O and a molecular weight of 244.68 g/mol. Its IUPAC name is N-(3-chlorophenyl)furo[3,2-c]pyridin-4-amine.
| Compound Name | N-(3-chlorophenyl)furo[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 25096012 |
| Molecular Formula | C13H9ClN2O |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | N-(3-chlorophenyl)furo[3,2-c]pyridin-4-amine |
| SMILES | Clc1cccc(Nc2nccc3occc23)c1 |
| InChI | InChI=1S/C13H9ClN2O/c14-9-2-1-3-10(8-9)16-13-11-5-7-17-12(11)4-6-15-13/h1-8H,(H,15,16) |
| InChIKey | QLYMHNFNFSMMHX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |