C16H15F3N4O — CID 25096016
6-[[(2R)-1,1,1-trifluoro-3-methylbutan-2-yl]amino]-2H-pyrido[4,3-c][1,6]naphthyridin-1-one (PubChem CID 25096016) has the molecular formula C16H15F3N4O and a molecular weight of 336.32 g/mol. Its IUPAC name is 6-[[(2R)-1,1,1-trifluoro-3-methylbutan-2-yl]amino]-2H-pyrido[4,3-c][1,6]naphthyridin-1-one.
| Compound Name | 6-[[(2R)-1,1,1-trifluoro-3-methylbutan-2-yl]amino]-2H-pyrido[4,3-c][1,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 25096016 |
| Molecular Formula | C16H15F3N4O |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 6-[[(2R)-1,1,1-trifluoro-3-methylbutan-2-yl]amino]-2H-pyrido[4,3-c][1,6]naphthyridin-1-one |
| SMILES | CC(C)[C@@H](Nc1nc2cc[nH]c(=O)c2c2cnccc12)C(F)(F)F |
| InChI | InChI=1S/C16H15F3N4O/c1-8(2)13(16(17,18)19)23-14-9-3-5-20-7-10(9)12-11(22-14)4-6-21-15(12)24/h3-8,13H,1-2H3,(H,21,24)(H,22,23)/t13-/m1/s1 |
| InChIKey | DBPPYNQBKGUMSZ-CYBMUJFWSA-N |
| XLogP | 3.47 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|