C20H18BrNO3S — CID 25097268
4-(4-bromophenyl)-N-[3-(hydroxymethyl)-2-methylphenyl]benzenesulfonamide (PubChem CID 25097268) has the molecular formula C20H18BrNO3S and a molecular weight of 432.34 g/mol. Its IUPAC name is 4-(4-bromophenyl)-N-[3-(hydroxymethyl)-2-methylphenyl]benzenesulfonamide.
| Compound Name | 4-(4-bromophenyl)-N-[3-(hydroxymethyl)-2-methylphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 25097268 |
| Molecular Formula | C20H18BrNO3S |
| Molecular Weight | 432.34 g/mol |
| Exact Mass | 431.02 |
| IUPAC Name | 4-(4-bromophenyl)-N-[3-(hydroxymethyl)-2-methylphenyl]benzenesulfonamide |
| SMILES | Cc1c(CO)cccc1NS(=O)(=O)c1ccc(-c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C20H18BrNO3S/c1-14-17(13-23)3-2-4-20(14)22-26(24,25)19-11-7-16(8-12-19)15-5-9-18(21)10-6-15/h2-12,22-23H,13H2,1H3 |
| InChIKey | GRXSAJHUYACZFJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.34 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |