C19H16FNO3S — CID 25097524
4-(4-fluorophenyl)-N-[3-(hydroxymethyl)phenyl]benzenesulfonamide (PubChem CID 25097524) has the molecular formula C19H16FNO3S and a molecular weight of 357.41 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-[3-(hydroxymethyl)phenyl]benzenesulfonamide.
| Compound Name | 4-(4-fluorophenyl)-N-[3-(hydroxymethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 25097524 |
| Molecular Formula | C19H16FNO3S |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 4-(4-fluorophenyl)-N-[3-(hydroxymethyl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(CO)c1)c1ccc(-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H16FNO3S/c20-17-8-4-15(5-9-17)16-6-10-19(11-7-16)25(23,24)21-18-3-1-2-14(12-18)13-22/h1-12,21-22H,13H2 |
| InChIKey | GDXFBKQIBDULBN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |