C28H19ClN6O2 — CID 25098487
4-(6-chloro-3-pyridinyl)-N-[4-[(7-methoxy-1,5-naphthyridin-4-yl)oxy]phenyl]phthalazin-1-amine (PubChem CID 25098487) has the molecular formula C28H19ClN6O2 and a molecular weight of 506.95 g/mol. Its IUPAC name is 4-(6-chloro-3-pyridinyl)-N-[4-[(7-methoxy-1,5-naphthyridin-4-yl)oxy]phenyl]phthalazin-1-amine.
| Compound Name | 4-(6-chloro-3-pyridinyl)-N-[4-[(7-methoxy-1,5-naphthyridin-4-yl)oxy]phenyl]phthalazin-1-amine |
|---|---|
| PubChem CID | 25098487 |
| Molecular Formula | C28H19ClN6O2 |
| Molecular Weight | 506.95 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | 4-(6-chloro-3-pyridinyl)-N-[4-[(7-methoxy-1,5-naphthyridin-4-yl)oxy]phenyl]phthalazin-1-amine |
| SMILES | COc1cnc2c(Oc3ccc(Nc4nnc(-c5ccc(Cl)nc5)c5ccccc45)cc3)ccnc2c1 |
| InChI | InChI=1S/C28H19ClN6O2/c1-36-20-14-23-27(32-16-20)24(12-13-30-23)37-19-9-7-18(8-10-19)33-28-22-5-3-2-4-21(22)26(34-35-28)17-6-11-25(29)31-15-17/h2-16H,1H3,(H,33,35) |
| InChIKey | BXEMAQODVCDTDW-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.95 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|