C30H29N7O2 — CID 90114367
4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-N-[4-[(7-methoxy-1,5-naphthyridin-4-yl)oxy]phenyl]phthalazin-1-amine (PubChem CID 90114367) has the molecular formula C30H29N7O2 and a molecular weight of 519.61 g/mol. Its IUPAC name is 4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-N-[4-[(7-methoxy-1,5-naphthyridin-4-yl)oxy]phenyl]phthalazin-1-amine.
| Compound Name | 4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-N-[4-[(7-methoxy-1,5-naphthyridin-4-yl)oxy]phenyl]phthalazin-1-amine |
|---|---|
| PubChem CID | 90114367 |
| Molecular Formula | C30H29N7O2 |
| Molecular Weight | 519.61 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | 4-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-N-[4-[(7-methoxy-1,5-naphthyridin-4-yl)oxy]phenyl]phthalazin-1-amine |
| SMILES | COc1cnc2c(Oc3ccc(Nc4nnc(N5CCN6CCC[C@H]6C5)c5ccccc45)cc3)ccnc2c1 |
| InChI | InChI=1S/C30H29N7O2/c1-38-23-17-26-28(32-18-23)27(12-13-31-26)39-22-10-8-20(9-11-22)33-29-24-6-2-3-7-25(24)30(35-34-29)37-16-15-36-14-4-5-21(36)19-37/h2-3,6-13,17-18,21H,4-5,14-16,19H2,1H3,(H,33,34)/t21-/m0/s1 |
| InChIKey | UHBQBXSTZAQOHZ-NRFANRHFSA-N |
| XLogP | 5.40 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.61 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |