C24H17F4NO3S — CID 25100151
4-[3-(3-fluoro-5-methylsulfonylphenoxy)phenyl]-3-methyl-8-(trifluoromethyl)quinoline (PubChem CID 25100151) has the molecular formula C24H17F4NO3S and a molecular weight of 475.46 g/mol. Its IUPAC name is 4-[3-(3-fluoro-5-methylsulfonylphenoxy)phenyl]-3-methyl-8-(trifluoromethyl)quinoline.
| Compound Name | 4-[3-(3-fluoro-5-methylsulfonylphenoxy)phenyl]-3-methyl-8-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 25100151 |
| Molecular Formula | C24H17F4NO3S |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | 4-[3-(3-fluoro-5-methylsulfonylphenoxy)phenyl]-3-methyl-8-(trifluoromethyl)quinoline |
| SMILES | Cc1cnc2c(C(F)(F)F)cccc2c1-c1cccc(Oc2cc(F)cc(S(C)(=O)=O)c2)c1 |
| InChI | InChI=1S/C24H17F4NO3S/c1-14-13-29-23-20(7-4-8-21(23)24(26,27)28)22(14)15-5-3-6-17(9-15)32-18-10-16(25)11-19(12-18)33(2,30)31/h3-13H,1-2H3 |
| InChIKey | HXANPPNXWQVOEO-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |