C19H17F6N — CID 25100422
3-[3-[(E)-2-[2,6-bis(trifluoromethyl)phenyl]ethenyl]phenyl]propan-1-amine (PubChem CID 25100422) has the molecular formula C19H17F6N and a molecular weight of 373.34 g/mol. Its IUPAC name is 3-[3-[(E)-2-[2,6-bis(trifluoromethyl)phenyl]ethenyl]phenyl]propan-1-amine.
| Compound Name | 3-[3-[(E)-2-[2,6-bis(trifluoromethyl)phenyl]ethenyl]phenyl]propan-1-amine |
|---|---|
| PubChem CID | 25100422 |
| Molecular Formula | C19H17F6N |
| Molecular Weight | 373.34 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 3-[3-[(E)-2-[2,6-bis(trifluoromethyl)phenyl]ethenyl]phenyl]propan-1-amine |
| SMILES | NCCCc1cccc(/C=C/c2c(C(F)(F)F)cccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C19H17F6N/c20-18(21,22)16-7-2-8-17(19(23,24)25)15(16)10-9-14-5-1-4-13(12-14)6-3-11-26/h1-2,4-5,7-10,12H,3,6,11,26H2/b10-9+ |
| InChIKey | NGNAJYMEOALPDA-MDZDMXLPSA-N |
| XLogP | 5.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.34 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|