C13H10F3NO5 — CID 25100980
2-[2-formamido-1-hydroxy-3-oxo-7-(trifluoromethyl)-1H-inden-2-yl]acetic acid (PubChem CID 25100980) has the molecular formula C13H10F3NO5 and a molecular weight of 317.22 g/mol. Its IUPAC name is 2-[2-formamido-1-hydroxy-3-oxo-7-(trifluoromethyl)-1H-inden-2-yl]acetic acid.
| Compound Name | 2-[2-formamido-1-hydroxy-3-oxo-7-(trifluoromethyl)-1H-inden-2-yl]acetic acid |
|---|---|
| PubChem CID | 25100980 |
| Molecular Formula | C13H10F3NO5 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 2-[2-formamido-1-hydroxy-3-oxo-7-(trifluoromethyl)-1H-inden-2-yl]acetic acid |
| SMILES | O=CNC1(CC(=O)O)C(=O)c2cccc(C(F)(F)F)c2C1O |
| InChI | InChI=1S/C13H10F3NO5/c14-13(15,16)7-3-1-2-6-9(7)11(22)12(10(6)21,17-5-18)4-8(19)20/h1-3,5,11,22H,4H2,(H,17,18)(H,19,20) |
| InChIKey | ZCRQMTGBKCCKCC-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|