C29H46O2 — CID 25101796
(4aS,6aR,6bR,12aS)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,12,13,14b-dodecahydropicene-4a,13-diol (PubChem CID 25101796) has the molecular formula C29H46O2 and a molecular weight of 426.69 g/mol. Its IUPAC name is (4aS,6aR,6bR,12aS)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,12,13,14b-dodecahydropicene-4a,13-diol.
| Compound Name | (4aS,6aR,6bR,12aS)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,12,13,14b-dodecahydropicene-4a,13-diol |
|---|---|
| PubChem CID | 25101796 |
| Molecular Formula | C29H46O2 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.35 |
| IUPAC Name | (4aS,6aR,6bR,12aS)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,12,13,14b-dodecahydropicene-4a,13-diol |
| SMILES | CC1(C)CC[C@]2(O)CC[C@@]3(C)C(=CC(O)C4[C@@]5(C)CC=CC(C)(C)C5CC[C@]43C)C2C1 |
| InChI | InChI=1S/C29H46O2/c1-24(2)13-15-29(31)16-14-27(6)19(20(29)18-24)17-21(30)23-26(5)11-8-10-25(3,4)22(26)9-12-28(23,27)7/h8,10,17,20-23,30-31H,9,11-16,18H2,1-7H3/t20?,21?,22?,23?,26-,27-,28+,29-/m0/s1 |
| InChIKey | VPXGPOBPQABYQS-ZZVQRWICSA-N |
| XLogP | 6.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|