C20H24N2O4S — CID 25103656
3-[3-(5-methoxyindol-1-yl)sulfonylphenoxy]-N,N-dimethylpropan-1-amine (PubChem CID 25103656) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is 3-[3-(5-methoxyindol-1-yl)sulfonylphenoxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[3-(5-methoxyindol-1-yl)sulfonylphenoxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 25103656 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 3-[3-(5-methoxyindol-1-yl)sulfonylphenoxy]-N,N-dimethylpropan-1-amine |
| SMILES | COc1ccc2c(ccn2S(=O)(=O)c2cccc(OCCCN(C)C)c2)c1 |
| InChI | InChI=1S/C20H24N2O4S/c1-21(2)11-5-13-26-18-6-4-7-19(15-18)27(23,24)22-12-10-16-14-17(25-3)8-9-20(16)22/h4,6-10,12,14-15H,5,11,13H2,1-3H3 |
| InChIKey | VVSBAOOOSAUEPA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|