C9H15NO3 — CID 25105413
cis-(1S,2R)-1-ethyl-2-(nitromethyl)cyclopentane-1-carbaldehyde (PubChem CID 25105413) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is cis-(1S,2R)-1-ethyl-2-(nitromethyl)cyclopentane-1-carbaldehyde.
| Compound Name | cis-(1S,2R)-1-ethyl-2-(nitromethyl)cyclopentane-1-carbaldehyde |
|---|---|
| PubChem CID | 25105413 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | cis-(1S,2R)-1-ethyl-2-(nitromethyl)cyclopentane-1-carbaldehyde |
| SMILES | CC[C@]1(C=O)CCC[C@H]1C[N+](=O)[O-] |
| InChI | InChI=1S/C9H15NO3/c1-2-9(7-11)5-3-4-8(9)6-10(12)13/h7-8H,2-6H2,1H3/t8-,9+/m0/s1 |
| InChIKey | WRGLSKBEDRMWGZ-DTWKUNHWSA-N |
| XLogP | 1.66 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|