C29H54O6Si2 — CID 25105532
(E,5S,7R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-3-(phenylmethoxymethyl)-7-(2-trimethylsilylethoxymethoxy)non-2-ene-1,5-diol (PubChem CID 25105532) has the molecular formula C29H54O6Si2 and a molecular weight of 554.92 g/mol. Its IUPAC name is (E,5S,7R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-3-(phenylmethoxymethyl)-7-(2-trimethylsilylethoxymethoxy)non-2-ene-1,5-diol.
| Compound Name | (E,5S,7R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-3-(phenylmethoxymethyl)-7-(2-trimethylsilylethoxymethoxy)non-2-ene-1,5-diol |
|---|---|
| PubChem CID | 25105532 |
| Molecular Formula | C29H54O6Si2 |
| Molecular Weight | 554.92 g/mol |
| Exact Mass | 554.35 |
| IUPAC Name | (E,5S,7R,8R)-8-[tert-butyl(dimethyl)silyl]oxy-3-(phenylmethoxymethyl)-7-(2-trimethylsilylethoxymethoxy)non-2-ene-1,5-diol |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C[C@@H](O)C/C(=C\CO)COCc1ccccc1)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C29H54O6Si2/c1-24(35-37(8,9)29(2,3)4)28(34-23-32-17-18-36(5,6)7)20-27(31)19-26(15-16-30)22-33-21-25-13-11-10-12-14-25/h10-15,24,27-28,30-31H,16-23H2,1-9H3/b26-15+/t24-,27+,28-/m1/s1 |
| InChIKey | PTSDKJGCCAIUDL-CZKICUKDSA-N |
| XLogP | 6.37 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.92 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|