C29H38N2O2 — CID 25107851
N,N-dihexyl-2-(7-methyl-2-phenyl-1H-indol-3-yl)-2-oxoacetamide (PubChem CID 25107851) has the molecular formula C29H38N2O2 and a molecular weight of 446.64 g/mol. Its IUPAC name is N,N-dihexyl-2-(7-methyl-2-phenyl-1H-indol-3-yl)-2-oxoacetamide.
| Compound Name | N,N-dihexyl-2-(7-methyl-2-phenyl-1H-indol-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 25107851 |
| Molecular Formula | C29H38N2O2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | N,N-dihexyl-2-(7-methyl-2-phenyl-1H-indol-3-yl)-2-oxoacetamide |
| SMILES | CCCCCCN(CCCCCC)C(=O)C(=O)c1c(-c2ccccc2)[nH]c2c(C)cccc12 |
| InChI | InChI=1S/C29H38N2O2/c1-4-6-8-13-20-31(21-14-9-7-5-2)29(33)28(32)25-24-19-15-16-22(3)26(24)30-27(25)23-17-11-10-12-18-23/h10-12,15-19,30H,4-9,13-14,20-21H2,1-3H3 |
| InChIKey | GPUJOZUASMEZGM-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|