C26H32N2O2 — CID 11350240
2-oxo-N,N-dipentyl-2-(2-phenyl-1H-indol-3-yl)acetamide (PubChem CID 11350240) has the molecular formula C26H32N2O2 and a molecular weight of 404.55 g/mol. Its IUPAC name is 2-oxo-N,N-dipentyl-2-(2-phenyl-1H-indol-3-yl)acetamide.
| Compound Name | 2-oxo-N,N-dipentyl-2-(2-phenyl-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 11350240 |
| Molecular Formula | C26H32N2O2 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | 2-oxo-N,N-dipentyl-2-(2-phenyl-1H-indol-3-yl)acetamide |
| SMILES | CCCCCN(CCCCC)C(=O)C(=O)c1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C26H32N2O2/c1-3-5-12-18-28(19-13-6-4-2)26(30)25(29)23-21-16-10-11-17-22(21)27-24(23)20-14-8-7-9-15-20/h7-11,14-17,27H,3-6,12-13,18-19H2,1-2H3 |
| InChIKey | FHQLVDDFLBGDOO-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|