C17H36O2Si — CID 25111168
tert-butyl-[(4S,6S)-6-methoxy-8-methylnon-8-en-4-yl]oxy-dimethylsilane (PubChem CID 25111168) has the molecular formula C17H36O2Si and a molecular weight of 300.56 g/mol. Its IUPAC name is tert-butyl-[(4S,6S)-6-methoxy-8-methylnon-8-en-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(4S,6S)-6-methoxy-8-methylnon-8-en-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 25111168 |
| Molecular Formula | C17H36O2Si |
| Molecular Weight | 300.56 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | tert-butyl-[(4S,6S)-6-methoxy-8-methylnon-8-en-4-yl]oxy-dimethylsilane |
| SMILES | C=C(C)C[C@@H](C[C@H](CCC)O[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C17H36O2Si/c1-10-11-15(13-16(18-7)12-14(2)3)19-20(8,9)17(4,5)6/h15-16H,2,10-13H2,1,3-9H3/t15-,16-/m0/s1 |
| InChIKey | BKJILDSYCQBFQH-HOTGVXAUSA-N |
| XLogP | 5.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.56 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|