C9H11IO2 — CID 25111397
(3aS,7aS)-4-iodo-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole (PubChem CID 25111397) has the molecular formula C9H11IO2 and a molecular weight of 278.09 g/mol. Its IUPAC name is (3aS,7aS)-4-iodo-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole.
| Compound Name | (3aS,7aS)-4-iodo-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole |
|---|---|
| PubChem CID | 25111397 |
| Molecular Formula | C9H11IO2 |
| Molecular Weight | 278.09 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | (3aS,7aS)-4-iodo-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxole |
| SMILES | CC1(C)O[C@H]2C=CC=C(I)[C@H]2O1 |
| InChI | InChI=1S/C9H11IO2/c1-9(2)11-7-5-3-4-6(10)8(7)12-9/h3-5,7-8H,1-2H3/t7-,8+/m0/s1 |
| InChIKey | YYPPMCOGAHAMOZ-JGVFFNPUSA-N |
| XLogP | 2.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.09 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|