C25H30N4O3S3 — CID 2511185
ethyl (6R)-6-methyl-2-[[2-[[5-(4-propan-2-ylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 2511185) has the molecular formula C25H30N4O3S3 and a molecular weight of 530.74 g/mol. Its IUPAC name is ethyl (6R)-6-methyl-2-[[2-[[5-(4-propan-2-ylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl (6R)-6-methyl-2-[[2-[[5-(4-propan-2-ylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 2511185 |
| Molecular Formula | C25H30N4O3S3 |
| Molecular Weight | 530.74 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | ethyl (6R)-6-methyl-2-[[2-[[5-(4-propan-2-ylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2nnc(Nc3ccc(C(C)C)cc3)s2)sc2c1CC[C@@H](C)C2 |
| InChI | InChI=1S/C25H30N4O3S3/c1-5-32-23(31)21-18-11-6-15(4)12-19(18)34-22(21)27-20(30)13-33-25-29-28-24(35-25)26-17-9-7-16(8-10-17)14(2)3/h7-10,14-15H,5-6,11-13H2,1-4H3,(H,26,28)(H,27,30)/t15-/m1/s1 |
| InChIKey | LBGDEODSQRQTOB-OAHLLOKOSA-N |
| XLogP | 6.50 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.74 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |