C19H37NO4Si — CID 25112311
tert-butyl (2S)-2-[4-[tert-butyl(dimethyl)silyl]oxy-3-oxobutyl]pyrrolidine-1-carboxylate (PubChem CID 25112311) has the molecular formula C19H37NO4Si and a molecular weight of 371.59 g/mol. Its IUPAC name is tert-butyl (2S)-2-[4-[tert-butyl(dimethyl)silyl]oxy-3-oxobutyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[4-[tert-butyl(dimethyl)silyl]oxy-3-oxobutyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 25112311 |
| Molecular Formula | C19H37NO4Si |
| Molecular Weight | 371.59 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | tert-butyl (2S)-2-[4-[tert-butyl(dimethyl)silyl]oxy-3-oxobutyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1CCC(=O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H37NO4Si/c1-18(2,3)24-17(22)20-13-9-10-15(20)11-12-16(21)14-23-25(7,8)19(4,5)6/h15H,9-14H2,1-8H3/t15-/m0/s1 |
| InChIKey | FVIRSQIWUHPIEB-HNNXBMFYSA-N |
| XLogP | 4.76 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.59 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|