C24H45NO5Si — CID 134951070
tert-butyl (2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(4,8-dioxooctyl)pyrrolidine-1-carboxylate (PubChem CID 134951070) has the molecular formula C24H45NO5Si and a molecular weight of 455.71 g/mol. Its IUPAC name is tert-butyl (2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(4,8-dioxooctyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(4,8-dioxooctyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 134951070 |
| Molecular Formula | C24H45NO5Si |
| Molecular Weight | 455.71 g/mol |
| Exact Mass | 455.31 |
| IUPAC Name | tert-butyl (2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(4,8-dioxooctyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](CCCC(=O)CCCC=O)CC[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H45NO5Si/c1-23(2,3)30-22(28)25-19(12-11-14-21(27)13-9-10-17-26)15-16-20(25)18-29-31(7,8)24(4,5)6/h17,19-20H,9-16,18H2,1-8H3/t19-,20-/m0/s1 |
| InChIKey | JFCJBYISHJCYMF-PMACEKPBSA-N |
| XLogP | 5.88 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.71 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|