C19H35NO5Si — CID 101221906
tert-butyl (2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-oxo-2-(4-oxobutyl)pyrrolidine-1-carboxylate (PubChem CID 101221906) has the molecular formula C19H35NO5Si and a molecular weight of 385.58 g/mol. Its IUPAC name is tert-butyl (2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-oxo-2-(4-oxobutyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-oxo-2-(4-oxobutyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 101221906 |
| Molecular Formula | C19H35NO5Si |
| Molecular Weight | 385.58 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | tert-butyl (2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-oxo-2-(4-oxobutyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@@H]1CCCC=O |
| InChI | InChI=1S/C19H35NO5Si/c1-18(2,3)24-17(23)20-13-15(25-26(7,8)19(4,5)6)16(22)14(20)11-9-10-12-21/h12,14-15H,9-11,13H2,1-8H3/t14-,15-/m0/s1 |
| InChIKey | LZWPQHMKSBDXDW-GJZGRUSLSA-N |
| XLogP | 3.93 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.58 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|