C26H35F3N6O6 — CID 25112637
trans-(3R,15S)-15-(4-aminobutyl)-3-(1H-indol-3-ylmethyl)-1,4,8,12-tetrazacyclopentadecane-2,5,9,13-tetrone;2,2,2-trifluoroacetic acid (PubChem CID 25112637) has the molecular formula C26H35F3N6O6 and a molecular weight of 584.60 g/mol. Its IUPAC name is trans-(3R,15S)-15-(4-aminobutyl)-3-(1H-indol-3-ylmethyl)-1,4,8,12-tetrazacyclopentadecane-2,5,9,13-tetrone;2,2,2-trifluoroacetic acid.
| Compound Name | trans-(3R,15S)-15-(4-aminobutyl)-3-(1H-indol-3-ylmethyl)-1,4,8,12-tetrazacyclopentadecane-2,5,9,13-tetrone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 25112637 |
| Molecular Formula | C26H35F3N6O6 |
| Molecular Weight | 584.60 g/mol |
| Exact Mass | 584.26 |
| IUPAC Name | trans-(3R,15S)-15-(4-aminobutyl)-3-(1H-indol-3-ylmethyl)-1,4,8,12-tetrazacyclopentadecane-2,5,9,13-tetrone;2,2,2-trifluoroacetic acid |
| SMILES | NCCCC[C@H]1CC(=O)NCCC(=O)NCCC(=O)N[C@H](Cc2c[nH]c3ccccc23)C(=O)N1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H34N6O4.C2HF3O2/c25-10-4-3-5-17-14-23(33)27-11-8-21(31)26-12-9-22(32)30-20(24(34)29-17)13-16-15-28-19-7-2-1-6-18(16)19;3-2(4,5)1(6)7/h1-2,6-7,15,17,20,28H,3-5,8-14,25H2,(H,26,31)(H,27,33)(H,29,34)(H,30,32);(H,6,7)/t17-,20+;/m0./s1 |
| InChIKey | RICRQWPJKKUXGQ-YFUYRHFLSA-N |
| XLogP | 0.86 |
| TPSA | 195.51 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.60 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|