C14H23NO8 — CID 25112855
(4S,6R,8R,9S,10S,11R)-9,10,11-trihydroxy-8-(hydroxymethyl)-3-methyl-4-[(2S)-oxolan-2-yl]-1,7-dioxa-3-azaspiro[5.5]undecan-2-one (PubChem CID 25112855) has the molecular formula C14H23NO8 and a molecular weight of 333.34 g/mol. Its IUPAC name is (4S,6R,8R,9S,10S,11R)-9,10,11-trihydroxy-8-(hydroxymethyl)-3-methyl-4-[(2S)-oxolan-2-yl]-1,7-dioxa-3-azaspiro[5.5]undecan-2-one.
| Compound Name | (4S,6R,8R,9S,10S,11R)-9,10,11-trihydroxy-8-(hydroxymethyl)-3-methyl-4-[(2S)-oxolan-2-yl]-1,7-dioxa-3-azaspiro[5.5]undecan-2-one |
|---|---|
| PubChem CID | 25112855 |
| Molecular Formula | C14H23NO8 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | (4S,6R,8R,9S,10S,11R)-9,10,11-trihydroxy-8-(hydroxymethyl)-3-methyl-4-[(2S)-oxolan-2-yl]-1,7-dioxa-3-azaspiro[5.5]undecan-2-one |
| SMILES | CN1C(=O)O[C@@]2(C[C@H]1[C@@H]1CCCO1)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O |
| InChI | InChI=1S/C14H23NO8/c1-15-7(8-3-2-4-21-8)5-14(23-13(15)20)12(19)11(18)10(17)9(6-16)22-14/h7-12,16-19H,2-6H2,1H3/t7-,8-,9+,10+,11-,12+,14+/m0/s1 |
| InChIKey | MYURHRRMENOFNM-GQDTXSMVSA-N |
| XLogP | -1.82 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |