C16H29NO8 — CID 46177822
tert-butyl (2R,3S,4R)-2-[(1R,2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,2-dihydroxyethyl]-3,4-dihydroxypyrrolidine-1-carboxylate (PubChem CID 46177822) has the molecular formula C16H29NO8 and a molecular weight of 363.41 g/mol. Its IUPAC name is tert-butyl (2R,3S,4R)-2-[(1R,2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,2-dihydroxyethyl]-3,4-dihydroxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S,4R)-2-[(1R,2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,2-dihydroxyethyl]-3,4-dihydroxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 46177822 |
| Molecular Formula | C16H29NO8 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | tert-butyl (2R,3S,4R)-2-[(1R,2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,2-dihydroxyethyl]-3,4-dihydroxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](O)[C@@H](O)[C@@H]1[C@@H](O)[C@H](O)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C16H29NO8/c1-15(2,3)25-14(22)17-6-8(18)11(19)10(17)13(21)12(20)9-7-23-16(4,5)24-9/h8-13,18-21H,6-7H2,1-5H3/t8-,9+,10-,11-,12-,13-/m1/s1 |
| InChIKey | RNBDZEQYCVCNKF-LREJFELKSA-N |
| XLogP | -0.80 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |